C3H4F2N4S — CID 115407856
1-(2,2-difluoroethyl)-2H-tetrazole-5-thione (PubChem CID 115407856) has the molecular formula C3H4F2N4S and a molecular weight of 166.16 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2H-tetrazole-5-thione.
| Compound Name | 1-(2,2-difluoroethyl)-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 115407856 |
| Molecular Formula | C3H4F2N4S |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2H-tetrazole-5-thione |
| SMILES | FC(F)Cn1[nH]nnc1=S |
| InChI | InChI=1S/C3H4F2N4S/c4-2(5)1-9-3(10)6-7-8-9/h2H,1H2,(H,6,8,10) |
| InChIKey | CNIPEIHMWIXHCX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|