C3H4F2N4S — CID 170922232
4-amino-3-(difluoromethyl)-3H-1,2,4-triazole-5-thione (PubChem CID 170922232) has the molecular formula C3H4F2N4S and a molecular weight of 166.16 g/mol. Its IUPAC name is 4-amino-3-(difluoromethyl)-3H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(difluoromethyl)-3H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 170922232 |
| Molecular Formula | C3H4F2N4S |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 4-amino-3-(difluoromethyl)-3H-1,2,4-triazole-5-thione |
| SMILES | NN1C(=S)N=NC1C(F)F |
| InChI | InChI=1S/C3H4F2N4S/c4-1(5)2-7-8-3(10)9(2)6/h1-2H,6H2 |
| InChIKey | JSNQWVQCJVGVOH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|