C3H6N4S — CID 88625342
4-amino-3-methyl-3H-1,2,4-triazole-5-thione (PubChem CID 88625342) has the molecular formula C3H6N4S and a molecular weight of 130.18 g/mol. Its IUPAC name is 4-amino-3-methyl-3H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-methyl-3H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 88625342 |
| Molecular Formula | C3H6N4S |
| Molecular Weight | 130.18 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 4-amino-3-methyl-3H-1,2,4-triazole-5-thione |
| SMILES | CC1N=NC(=S)N1N |
| InChI | InChI=1S/C3H6N4S/c1-2-5-6-3(8)7(2)4/h2H,4H2,1H3 |
| InChIKey | OHWQYCPUUWVLDI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|