C8H11N3OS — CID 130618814
N-(1,2,5-thiadiazol-3-yl)cyclopentanecarboxamide (PubChem CID 130618814) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is N-(1,2,5-thiadiazol-3-yl)cyclopentanecarboxamide.
| Compound Name | N-(1,2,5-thiadiazol-3-yl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 130618814 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | N-(1,2,5-thiadiazol-3-yl)cyclopentanecarboxamide |
| SMILES | O=C(Nc1cnsn1)C1CCCC1 |
| InChI | InChI=1S/C8H11N3OS/c12-8(6-3-1-2-4-6)10-7-5-9-13-11-7/h5-6H,1-4H2,(H,10,11,12) |
| InChIKey | RSYZSHPXVQFKPM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |