C9H13N3O2 — CID 143329379
N-(1,2,5-oxadiazol-3-yl)cyclohexanecarboxamide (PubChem CID 143329379) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is N-(1,2,5-oxadiazol-3-yl)cyclohexanecarboxamide.
| Compound Name | N-(1,2,5-oxadiazol-3-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 143329379 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-(1,2,5-oxadiazol-3-yl)cyclohexanecarboxamide |
| SMILES | O=C(Nc1cnon1)C1CCCCC1 |
| InChI | InChI=1S/C9H13N3O2/c13-9(7-4-2-1-3-5-7)11-8-6-10-14-12-8/h6-7H,1-5H2,(H,11,12,13) |
| InChIKey | DDCBJCYKFQQHRF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |