C10H14N2S — CID 130619317
2-(3,6-dihydro-2H-pyridin-1-yl)-4-ethyl-1,3-thiazole (PubChem CID 130619317) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyridin-1-yl)-4-ethyl-1,3-thiazole.
| Compound Name | 2-(3,6-dihydro-2H-pyridin-1-yl)-4-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 130619317 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyridin-1-yl)-4-ethyl-1,3-thiazole |
| SMILES | CCc1csc(N2CC=CCC2)n1 |
| InChI | InChI=1S/C10H14N2S/c1-2-9-8-13-10(11-9)12-6-4-3-5-7-12/h3-4,8H,2,5-7H2,1H3 |
| InChIKey | QNLGECMCGWMBTM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|