C7H7N3OS — CID 130621107
N-(1,3-thiazol-4-ylmethyl)-1,2-oxazol-3-amine (PubChem CID 130621107) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-1,2-oxazol-3-amine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 130621107 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-1,2-oxazol-3-amine |
| SMILES | c1cc(NCc2cscn2)no1 |
| InChI | InChI=1S/C7H7N3OS/c1-2-11-10-7(1)8-3-6-4-12-5-9-6/h1-2,4-5H,3H2,(H,8,10) |
| InChIKey | JTZADBRQENHZTH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |