About N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride
N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride (PubChem CID 130621806) has the molecular formula C8H14ClNO3
and a molecular weight of 207.66 g/mol. Its IUPAC name is N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride |
| PubChem CID | 130621806 |
| Molecular Formula | C8H14ClNO3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride |
| SMILES | CCN(C)C(=O)C1=COCCO1.Cl |
| InChI | InChI=1S/C8H13NO3.ClH/c1-3-9(2)8(10)7-6-11-4-5-12-7;/h6H,3-5H2,1-2H3;1H |
| InChIKey | NUMNZHIGNFJNDT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride?
The IUPAC name of N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride (CID 130621806) is N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride.
What is the SMILES notation for N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride?
The canonical SMILES for N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride is CCN(C)C(=O)C1=COCCO1.Cl.
What is the InChIKey of N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride?
The InChIKey is NUMNZHIGNFJNDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3.ClH/c1-3-9(2)8(10)7-6-11-4-5-12-7;/h6H,3-5H2,1-2H3;1H.
What are the key properties of N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride?
N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride has a molecular weight of 207.66 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-2,3-dihydro-1,4-dioxine-5-carboxamide;hydrochloride is sourced from PubChem (CID 130621806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).