About 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid
2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid (PubChem CID 28789456) has the molecular formula C7H9NO5
and a molecular weight of 187.15 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid.
Analyze 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid?
The IUPAC name of 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid (CID 28789456) is 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid.
What is the SMILES notation for 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid?
The canonical SMILES for 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid is O=C(O)CNC(=O)C1=COCCO1.
What is the InChIKey of 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid?
The InChIKey is VFKUUIJEDGCTFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO5/c9-6(10)3-8-7(11)5-4-12-1-2-13-5/h4H,1-3H2,(H,8,11)(H,9,10).
What are the key properties of 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid?
2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid has a molecular weight of 187.15 g/mol, XLogP of -0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,4-dioxine-5-carbonylamino)acetic acid is sourced from PubChem (CID 28789456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).