C9H15NO5 — CID 60670759
N-[2-(2-hydroxyethoxy)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 60670759) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 60670759 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(NCCOCCO)C1=COCCO1 |
| InChI | InChI=1S/C9H15NO5/c11-2-4-13-3-1-10-9(12)8-7-14-5-6-15-8/h7,11H,1-6H2,(H,10,12) |
| InChIKey | OVSPJAXJOFLLOQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|