C9H11NO2 — CID 130622044
N-but-2-ynyl-2,3-dihydrofuran-5-carboxamide (PubChem CID 130622044) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is N-but-2-ynyl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-but-2-ynyl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130622044 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N-but-2-ynyl-2,3-dihydrofuran-5-carboxamide |
| SMILES | CC#CCNC(=O)C1=CCCO1 |
| InChI | InChI=1S/C9H11NO2/c1-2-3-6-10-9(11)8-5-4-7-12-8/h5H,4,6-7H2,1H3,(H,10,11) |
| InChIKey | JFYZLBFPKSWLBM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|