C7H10FNO2 — CID 130723672
N-(2-fluoroethyl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 130723672) has the molecular formula C7H10FNO2 and a molecular weight of 159.16 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-(2-fluoroethyl)-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130723672 |
| Molecular Formula | C7H10FNO2 |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | N-(2-fluoroethyl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | O=C(NCCF)C1=CCCO1 |
| InChI | InChI=1S/C7H10FNO2/c8-3-4-9-7(10)6-2-1-5-11-6/h2H,1,3-5H2,(H,9,10) |
| InChIKey | NAWGPEXXJZUGNB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |