C12H14BrIO — CID 130624288
1-(5-bromo-2-iodophenyl)-2,3-dimethylbutan-1-one (PubChem CID 130624288) has the molecular formula C12H14BrIO and a molecular weight of 381.05 g/mol. Its IUPAC name is 1-(5-bromo-2-iodophenyl)-2,3-dimethylbutan-1-one.
| Compound Name | 1-(5-bromo-2-iodophenyl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 130624288 |
| Molecular Formula | C12H14BrIO |
| Molecular Weight | 381.05 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 1-(5-bromo-2-iodophenyl)-2,3-dimethylbutan-1-one |
| SMILES | CC(C)C(C)C(=O)c1cc(Br)ccc1I |
| InChI | InChI=1S/C12H14BrIO/c1-7(2)8(3)12(15)10-6-9(13)4-5-11(10)14/h4-8H,1-3H3 |
| InChIKey | WKIZMXSJGIQGTN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.05 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|