C11H8ClNOS — CID 130624383
(2-chloro-4-methylphenyl)-(1,2-thiazol-3-yl)methanone (PubChem CID 130624383) has the molecular formula C11H8ClNOS and a molecular weight of 237.71 g/mol. Its IUPAC name is (2-chloro-4-methylphenyl)-(1,2-thiazol-3-yl)methanone.
| Compound Name | (2-chloro-4-methylphenyl)-(1,2-thiazol-3-yl)methanone |
|---|---|
| PubChem CID | 130624383 |
| Molecular Formula | C11H8ClNOS |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | (2-chloro-4-methylphenyl)-(1,2-thiazol-3-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccsn2)c(Cl)c1 |
| InChI | InChI=1S/C11H8ClNOS/c1-7-2-3-8(9(12)6-7)11(14)10-4-5-15-13-10/h2-6H,1H3 |
| InChIKey | YACQOBJRTABTND-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |