C12H20N2 — CID 130625593
4-[(1S)-1-amino-2,2-dimethylpropyl]-N-methylaniline (PubChem CID 130625593) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-[(1S)-1-amino-2,2-dimethylpropyl]-N-methylaniline.
| Compound Name | 4-[(1S)-1-amino-2,2-dimethylpropyl]-N-methylaniline |
|---|---|
| PubChem CID | 130625593 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-[(1S)-1-amino-2,2-dimethylpropyl]-N-methylaniline |
| SMILES | CNc1ccc([C@@H](N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H20N2/c1-12(2,3)11(13)9-5-7-10(14-4)8-6-9/h5-8,11,14H,13H2,1-4H3/t11-/m1/s1 |
| InChIKey | JIYHYNAVXLICAD-LLVKDONJSA-N |
| XLogP | 2.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |