C7H11NO4S — CID 130625620
(4-oxo-5-oxaspiro[2.4]heptan-6-yl)methanesulfonamide (PubChem CID 130625620) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is (4-oxo-5-oxaspiro[2.4]heptan-6-yl)methanesulfonamide.
| Compound Name | (4-oxo-5-oxaspiro[2.4]heptan-6-yl)methanesulfonamide |
|---|---|
| PubChem CID | 130625620 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (4-oxo-5-oxaspiro[2.4]heptan-6-yl)methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC2(CC2)C(=O)O1 |
| InChI | InChI=1S/C7H11NO4S/c8-13(10,11)4-5-3-7(1-2-7)6(9)12-5/h5H,1-4H2,(H2,8,10,11) |
| InChIKey | VKPMKWOIPCBNFI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |