C22H33N3O4S — CID 153285771
(3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-methylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 153285771) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-methylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-methylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 153285771 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-methylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | Cc1ccc(N2CCN(CC[C@H]3CC4(CCN(S(C)(=O)=O)CC4)C(=O)O3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O4S/c1-18-3-5-19(6-4-18)24-15-13-23(14-16-24)10-7-20-17-22(21(26)29-20)8-11-25(12-9-22)30(2,27)28/h3-6,20H,7-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | HAABJSKHNYVPIS-FQEVSTJZSA-N |
| XLogP | 1.86 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|