C24H34F3N3O2S — CID 147415817
3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-(3,3,3-trifluoropropylsulfanyl)-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 147415817) has the molecular formula C24H34F3N3O2S and a molecular weight of 485.62 g/mol. Its IUPAC name is 3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-(3,3,3-trifluoropropylsulfanyl)-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | 3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-(3,3,3-trifluoropropylsulfanyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 147415817 |
| Molecular Formula | C24H34F3N3O2S |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-(3,3,3-trifluoropropylsulfanyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | Cc1ccc(N2CCN(CCC3CC4(CCN(SCCC(F)(F)F)CC4)C(=O)O3)CC2)cc1 |
| InChI | InChI=1S/C24H34F3N3O2S/c1-19-2-4-20(5-3-19)29-15-13-28(14-16-29)10-6-21-18-23(22(31)32-21)7-11-30(12-8-23)33-17-9-24(25,26)27/h2-5,21H,6-18H2,1H3 |
| InChIKey | DRMYVBUXHZWOED-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|