C25H33N3O4S2 — CID 151156953
(3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-thiophen-2-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 151156953) has the molecular formula C25H33N3O4S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-thiophen-2-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-thiophen-2-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 151156953 |
| Molecular Formula | C25H33N3O4S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-thiophen-2-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | Cc1ccc(N2CCN(CC[C@H]3CC4(CCN(S(=O)(=O)c5cccs5)CC4)C(=O)O3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O4S2/c1-20-4-6-21(7-5-20)27-16-14-26(15-17-27)11-8-22-19-25(24(29)32-22)9-12-28(13-10-25)34(30,31)23-3-2-18-33-23/h2-7,18,22H,8-17,19H2,1H3/t22-/m0/s1 |
| InChIKey | MZLBRMJTBKASGX-QFIPXVFZSA-N |
| XLogP | 3.36 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|