C27H41N3O4S — CID 153285786
(3R)-8-cyclohexylsulfonyl-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 153285786) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is (3R)-8-cyclohexylsulfonyl-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | (3R)-8-cyclohexylsulfonyl-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 153285786 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (3R)-8-cyclohexylsulfonyl-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | Cc1ccc(N2CCN(CC[C@H]3CC4(CCN(S(=O)(=O)C5CCCCC5)CC4)C(=O)O3)CC2)cc1 |
| InChI | InChI=1S/C27H41N3O4S/c1-22-7-9-23(10-8-22)29-19-17-28(18-20-29)14-11-24-21-27(26(31)34-24)12-15-30(16-13-27)35(32,33)25-5-3-2-4-6-25/h7-10,24-25H,2-6,11-21H2,1H3/t24-/m0/s1 |
| InChIKey | KDOXPDDODOMYHZ-DEOSSOPVSA-N |
| XLogP | 3.57 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|