C21H30N2O3 — CID 140837559
(3S)-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]ethyl]-2-oxaspiro[4.5]decan-1-one (PubChem CID 140837559) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3S)-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]ethyl]-2-oxaspiro[4.5]decan-1-one.
| Compound Name | (3S)-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]ethyl]-2-oxaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 140837559 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (3S)-3-[2-[4-(4-hydroxyphenyl)piperazin-1-yl]ethyl]-2-oxaspiro[4.5]decan-1-one |
| SMILES | O=C1O[C@H](CCN2CCN(c3ccc(O)cc3)CC2)CC12CCCCC2 |
| InChI | InChI=1S/C21H30N2O3/c24-18-6-4-17(5-7-18)23-14-12-22(13-15-23)11-8-19-16-21(20(25)26-19)9-2-1-3-10-21/h4-7,19,24H,1-3,8-16H2/t19-/m1/s1 |
| InChIKey | NMICCFZAMXQGAL-LJQANCHMSA-N |
| XLogP | 3.17 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |