C26H34N4O4S — CID 151746374
(3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-pyridin-3-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 151746374) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-pyridin-3-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-pyridin-3-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 151746374 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (3R)-3-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-8-pyridin-3-ylsulfonyl-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | Cc1ccc(N2CCN(CC[C@H]3CC4(CCN(S(=O)(=O)c5cccnc5)CC4)C(=O)O3)CC2)cc1 |
| InChI | InChI=1S/C26H34N4O4S/c1-21-4-6-22(7-5-21)29-17-15-28(16-18-29)12-8-23-19-26(25(31)34-23)9-13-30(14-10-26)35(32,33)24-3-2-11-27-20-24/h2-7,11,20,23H,8-10,12-19H2,1H3/t23-/m0/s1 |
| InChIKey | RNPKANUIEAXNOT-QHCPKHFHSA-N |
| XLogP | 2.69 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|