C7H11N3O3 — CID 130626516
1-(2-methoxyethyl)-3-(1,3-oxazol-4-yl)urea (PubChem CID 130626516) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(1,3-oxazol-4-yl)urea.
| Compound Name | 1-(2-methoxyethyl)-3-(1,3-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 130626516 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(1,3-oxazol-4-yl)urea |
| SMILES | COCCNC(=O)Nc1cocn1 |
| InChI | InChI=1S/C7H11N3O3/c1-12-3-2-8-7(11)10-6-4-13-5-9-6/h4-5H,2-3H2,1H3,(H2,8,10,11) |
| InChIKey | VVBTWARHNQJBAQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|