C15H5N3 — CID 13062652
acenaphthylene-1,2,5-tricarbonitrile (PubChem CID 13062652) has the molecular formula C15H5N3 and a molecular weight of 227.23 g/mol. Its IUPAC name is acenaphthylene-1,2,5-tricarbonitrile.
| Compound Name | acenaphthylene-1,2,5-tricarbonitrile |
|---|---|
| PubChem CID | 13062652 |
| Molecular Formula | C15H5N3 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | acenaphthylene-1,2,5-tricarbonitrile |
| SMILES | N#CC1=C(C#N)c2ccc(C#N)c3cccc1c23 |
| InChI | InChI=1S/C15H5N3/c16-6-9-4-5-12-14(8-18)13(7-17)11-3-1-2-10(9)15(11)12/h1-5H |
| InChIKey | LLSNFLCCHNTXNG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |