C9H10BrF2N — CID 130626598
(1R)-1-(2-bromo-4-methylphenyl)-2,2-difluoroethanamine (PubChem CID 130626598) has the molecular formula C9H10BrF2N and a molecular weight of 250.09 g/mol. Its IUPAC name is (1R)-1-(2-bromo-4-methylphenyl)-2,2-difluoroethanamine.
| Compound Name | (1R)-1-(2-bromo-4-methylphenyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 130626598 |
| Molecular Formula | C9H10BrF2N |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | (1R)-1-(2-bromo-4-methylphenyl)-2,2-difluoroethanamine |
| SMILES | Cc1ccc([C@@H](N)C(F)F)c(Br)c1 |
| InChI | InChI=1S/C9H10BrF2N/c1-5-2-3-6(7(10)4-5)8(13)9(11)12/h2-4,8-9H,13H2,1H3/t8-/m1/s1 |
| InChIKey | YARBGJNNGQJFDT-MRVPVSSYSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |