C7H14ClFN2O — CID 130629041
N-ethyl-3-fluoropyrrolidine-3-carboxamide;hydrochloride (PubChem CID 130629041) has the molecular formula C7H14ClFN2O and a molecular weight of 196.65 g/mol. Its IUPAC name is N-ethyl-3-fluoropyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-ethyl-3-fluoropyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130629041 |
| Molecular Formula | C7H14ClFN2O |
| Molecular Weight | 196.65 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-ethyl-3-fluoropyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CCNC(=O)C1(F)CCNC1.Cl |
| InChI | InChI=1S/C7H13FN2O.ClH/c1-2-10-6(11)7(8)3-4-9-5-7;/h9H,2-5H2,1H3,(H,10,11);1H |
| InChIKey | REFZQINIAOHNSJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.65 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |