C7H13FN2O — CID 129410919
(3R)-3-fluoro-N,N-dimethylpyrrolidine-3-carboxamide (PubChem CID 129410919) has the molecular formula C7H13FN2O and a molecular weight of 160.19 g/mol. Its IUPAC name is (3R)-3-fluoro-N,N-dimethylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-3-fluoro-N,N-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 129410919 |
| Molecular Formula | C7H13FN2O |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | (3R)-3-fluoro-N,N-dimethylpyrrolidine-3-carboxamide |
| SMILES | CN(C)C(=O)[C@@]1(F)CCNC1 |
| InChI | InChI=1S/C7H13FN2O/c1-10(2)6(11)7(8)3-4-9-5-7/h9H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | IODVTOYNGVVRBV-SSDOTTSWSA-N |
| XLogP | -0.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |