C11H17N3 — CID 130631034
3-methyl-2-N-(1-methylazetidin-3-yl)benzene-1,2-diamine (PubChem CID 130631034) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-methyl-2-N-(1-methylazetidin-3-yl)benzene-1,2-diamine.
| Compound Name | 3-methyl-2-N-(1-methylazetidin-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 130631034 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-methyl-2-N-(1-methylazetidin-3-yl)benzene-1,2-diamine |
| SMILES | Cc1cccc(N)c1NC1CN(C)C1 |
| InChI | InChI=1S/C11H17N3/c1-8-4-3-5-10(12)11(8)13-9-6-14(2)7-9/h3-5,9,13H,6-7,12H2,1-2H3 |
| InChIKey | LATIBXAXVDZOQI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|