About 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one
3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one (PubChem CID 130631338) has the molecular formula C8H8BrNO3S
and a molecular weight of 278.13 g/mol. Its IUPAC name is 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one.
Molecular Properties
| Compound Name | 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one |
| PubChem CID | 130631338 |
| Molecular Formula | C8H8BrNO3S |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one |
| SMILES | O=C(C#CBr)N1CC2CC1CS2(=O)=O |
| InChI | InChI=1S/C8H8BrNO3S/c9-2-1-8(11)10-4-7-3-6(10)5-14(7,12)13/h6-7H,3-5H2 |
| InChIKey | OFVIGZYLMZPTAV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one?
The IUPAC name of 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one (CID 130631338) is 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one.
What is the SMILES notation for 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one?
The canonical SMILES for 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one is O=C(C#CBr)N1CC2CC1CS2(=O)=O.
What is the InChIKey of 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one?
The InChIKey is OFVIGZYLMZPTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO3S/c9-2-1-8(11)10-4-7-3-6(10)5-14(7,12)13/h6-7H,3-5H2.
What are the key properties of 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one?
3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one has a molecular weight of 278.13 g/mol, XLogP of -0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptan-5-yl)prop-2-yn-1-one is sourced from PubChem (CID 130631338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).