C10H14BrNO — CID 130870129
3-bromo-1-(2-ethyl-4-methylpyrrolidin-1-yl)prop-2-yn-1-one (PubChem CID 130870129) has the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. Its IUPAC name is 3-bromo-1-(2-ethyl-4-methylpyrrolidin-1-yl)prop-2-yn-1-one.
| Compound Name | 3-bromo-1-(2-ethyl-4-methylpyrrolidin-1-yl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 130870129 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 3-bromo-1-(2-ethyl-4-methylpyrrolidin-1-yl)prop-2-yn-1-one |
| SMILES | CCC1CC(C)CN1C(=O)C#CBr |
| InChI | InChI=1S/C10H14BrNO/c1-3-9-6-8(2)7-12(9)10(13)4-5-11/h8-9H,3,6-7H2,1-2H3 |
| InChIKey | NPJOQGZXXQSTLL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|