C11H23N — CID 130634772
N-butan-2-yl-N,2-dimethylcyclopentan-1-amine (PubChem CID 130634772) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is N-butan-2-yl-N,2-dimethylcyclopentan-1-amine.
| Compound Name | N-butan-2-yl-N,2-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 130634772 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N-butan-2-yl-N,2-dimethylcyclopentan-1-amine |
| SMILES | CCC(C)N(C)C1CCCC1C |
| InChI | InChI=1S/C11H23N/c1-5-10(3)12(4)11-8-6-7-9(11)2/h9-11H,5-8H2,1-4H3 |
| InChIKey | RNCTVRVQJDOOFU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |