C10H8Cl2O — CID 130635174
2-but-2-ynoxy-1,3-dichlorobenzene (PubChem CID 130635174) has the molecular formula C10H8Cl2O and a molecular weight of 215.08 g/mol. Its IUPAC name is 2-but-2-ynoxy-1,3-dichlorobenzene.
| Compound Name | 2-but-2-ynoxy-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 130635174 |
| Molecular Formula | C10H8Cl2O |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-but-2-ynoxy-1,3-dichlorobenzene |
| SMILES | CC#CCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H8Cl2O/c1-2-3-7-13-10-8(11)5-4-6-9(10)12/h4-6H,7H2,1H3 |
| InChIKey | OTSSWKJJFJZTGR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|