C7H8F2N2O — CID 130636814
2-(2,2-difluoroethyl)-5-methylpyridazin-3-one (PubChem CID 130636814) has the molecular formula C7H8F2N2O and a molecular weight of 174.15 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-5-methylpyridazin-3-one.
| Compound Name | 2-(2,2-difluoroethyl)-5-methylpyridazin-3-one |
|---|---|
| PubChem CID | 130636814 |
| Molecular Formula | C7H8F2N2O |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 2-(2,2-difluoroethyl)-5-methylpyridazin-3-one |
| SMILES | Cc1cnn(CC(F)F)c(=O)c1 |
| InChI | InChI=1S/C7H8F2N2O/c1-5-2-7(12)11(10-3-5)4-6(8)9/h2-3,6H,4H2,1H3 |
| InChIKey | SZZFEGJNWYRZSJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |