C10H14F2N2O — CID 176827802
5-tert-butyl-2-(2,2-difluoroethyl)pyridazin-3-one (PubChem CID 176827802) has the molecular formula C10H14F2N2O and a molecular weight of 216.23 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,2-difluoroethyl)pyridazin-3-one.
| Compound Name | 5-tert-butyl-2-(2,2-difluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 176827802 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 5-tert-butyl-2-(2,2-difluoroethyl)pyridazin-3-one |
| SMILES | CC(C)(C)c1cnn(CC(F)F)c(=O)c1 |
| InChI | InChI=1S/C10H14F2N2O/c1-10(2,3)7-4-9(15)14(13-5-7)6-8(11)12/h4-5,8H,6H2,1-3H3 |
| InChIKey | XYTQNSGTDPRNOV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |