C9H14F2N2O — CID 169135440
2-(2,2-difluoroethyl)-5-methylpyridazin-3-one;ethane (PubChem CID 169135440) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-5-methylpyridazin-3-one;ethane.
| Compound Name | 2-(2,2-difluoroethyl)-5-methylpyridazin-3-one;ethane |
|---|---|
| PubChem CID | 169135440 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-(2,2-difluoroethyl)-5-methylpyridazin-3-one;ethane |
| SMILES | CC.Cc1cnn(CC(F)F)c(=O)c1 |
| InChI | InChI=1S/C7H8F2N2O.C2H6/c1-5-2-7(12)11(10-3-5)4-6(8)9;1-2/h2-3,6H,4H2,1H3;1-2H3 |
| InChIKey | XCQLUKLFOILBDV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |