C9H12F3N3O — CID 106549116
5-methyl-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one (PubChem CID 106549116) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is 5-methyl-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-methyl-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 106549116 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 5-methyl-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one |
| SMILES | Cc1cnn(CCNCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C9H12F3N3O/c1-7-4-8(16)15(14-5-7)3-2-13-6-9(10,11)12/h4-5,13H,2-3,6H2,1H3 |
| InChIKey | ACAKKFCTYJZYOO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|