C9H12F2N2O — CID 178099321
2-(2,2-difluoroethyl)-4-propan-2-ylpyridazin-3-one (PubChem CID 178099321) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-4-propan-2-ylpyridazin-3-one.
| Compound Name | 2-(2,2-difluoroethyl)-4-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 178099321 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-(2,2-difluoroethyl)-4-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)c1ccnn(CC(F)F)c1=O |
| InChI | InChI=1S/C9H12F2N2O/c1-6(2)7-3-4-12-13(9(7)14)5-8(10)11/h3-4,6,8H,5H2,1-2H3 |
| InChIKey | SLIQULVZDLRLJR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |