About 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane
4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane (PubChem CID 130636933) has the molecular formula C11H20BrNO
and a molecular weight of 262.19 g/mol. Its IUPAC name is 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane |
| PubChem CID | 130636933 |
| Molecular Formula | C11H20BrNO |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane |
| SMILES | C=C(Br)CN1CCCOC(C(C)C)C1 |
| InChI | InChI=1S/C11H20BrNO/c1-9(2)11-8-13(7-10(3)12)5-4-6-14-11/h9,11H,3-8H2,1-2H3 |
| InChIKey | GVALGHFCHUWOHR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane?
The IUPAC name of 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane (CID 130636933) is 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane.
What is the SMILES notation for 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane?
The canonical SMILES for 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane is C=C(Br)CN1CCCOC(C(C)C)C1.
What is the InChIKey of 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane?
The InChIKey is GVALGHFCHUWOHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrNO/c1-9(2)11-8-13(7-10(3)12)5-4-6-14-11/h9,11H,3-8H2,1-2H3.
What are the key properties of 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane?
4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane has a molecular weight of 262.19 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoprop-2-enyl)-2-propan-2-yl-1,4-oxazepane is sourced from PubChem (CID 130636933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).