C9H17ClN2O2 — CID 130637833
(2R)-N-[(3-methyloxetan-3-yl)methyl]azetidine-2-carboxamide;hydrochloride (PubChem CID 130637833) has the molecular formula C9H17ClN2O2 and a molecular weight of 220.70 g/mol. Its IUPAC name is (2R)-N-[(3-methyloxetan-3-yl)methyl]azetidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-[(3-methyloxetan-3-yl)methyl]azetidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130637833 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (2R)-N-[(3-methyloxetan-3-yl)methyl]azetidine-2-carboxamide;hydrochloride |
| SMILES | CC1(CNC(=O)[C@H]2CCN2)COC1.Cl |
| InChI | InChI=1S/C9H16N2O2.ClH/c1-9(5-13-6-9)4-11-8(12)7-2-3-10-7;/h7,10H,2-6H2,1H3,(H,11,12);1H/t7-;/m1./s1 |
| InChIKey | OCBIQNQQXLOPMX-OGFXRTJISA-N |
| XLogP | -0.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |