C10H14BrNO2 — CID 130638115
(2R,3R)-N-[(4-bromofuran-2-yl)methyl]-2-methyloxolan-3-amine (PubChem CID 130638115) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is (2R,3R)-N-[(4-bromofuran-2-yl)methyl]-2-methyloxolan-3-amine.
| Compound Name | (2R,3R)-N-[(4-bromofuran-2-yl)methyl]-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 130638115 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (2R,3R)-N-[(4-bromofuran-2-yl)methyl]-2-methyloxolan-3-amine |
| SMILES | C[C@H]1OCC[C@H]1NCc1cc(Br)co1 |
| InChI | InChI=1S/C10H14BrNO2/c1-7-10(2-3-13-7)12-5-9-4-8(11)6-14-9/h4,6-7,10,12H,2-3,5H2,1H3/t7-,10-/m1/s1 |
| InChIKey | ODGJGRCIRSEHRR-GMSGAONNSA-N |
| XLogP | 2.31 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |