C12H16BrNO2 — CID 115868288
4-bromo-3-[[(2-methyloxolan-3-yl)amino]methyl]phenol (PubChem CID 115868288) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 4-bromo-3-[[(2-methyloxolan-3-yl)amino]methyl]phenol.
| Compound Name | 4-bromo-3-[[(2-methyloxolan-3-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115868288 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-bromo-3-[[(2-methyloxolan-3-yl)amino]methyl]phenol |
| SMILES | CC1OCCC1NCc1cc(O)ccc1Br |
| InChI | InChI=1S/C12H16BrNO2/c1-8-12(4-5-16-8)14-7-9-6-10(15)2-3-11(9)13/h2-3,6,8,12,14-15H,4-5,7H2,1H3 |
| InChIKey | VBBZNXMNXKNTHR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |