C15H18BrNO2 — CID 82725346
N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-methyloxolan-3-amine (PubChem CID 82725346) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-methyloxolan-3-amine.
| Compound Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 82725346 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-methyloxolan-3-amine |
| SMILES | C#CCOc1ccc(Br)cc1CNC1CCOC1C |
| InChI | InChI=1S/C15H18BrNO2/c1-3-7-19-15-5-4-13(16)9-12(15)10-17-14-6-8-18-11(14)2/h1,4-5,9,11,14,17H,6-8,10H2,2H3 |
| InChIKey | WIVXVXYFWMBDLS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|