C10H14N2O — CID 130638335
4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-oxazole (PubChem CID 130638335) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-oxazole.
| Compound Name | 4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 130638335 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1,3-oxazole |
| SMILES | CC1=CCCN(Cc2cocn2)C1 |
| InChI | InChI=1S/C10H14N2O/c1-9-3-2-4-12(5-9)6-10-7-13-8-11-10/h3,7-8H,2,4-6H2,1H3 |
| InChIKey | LFBFVPDLJHETNO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|