C9H11N3O2 — CID 130641897
(6R)-6-(1-methylimidazol-2-yl)piperidine-2,4-dione (PubChem CID 130641897) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is (6R)-6-(1-methylimidazol-2-yl)piperidine-2,4-dione.
| Compound Name | (6R)-6-(1-methylimidazol-2-yl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 130641897 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (6R)-6-(1-methylimidazol-2-yl)piperidine-2,4-dione |
| SMILES | Cn1ccnc1[C@H]1CC(=O)CC(=O)N1 |
| InChI | InChI=1S/C9H11N3O2/c1-12-3-2-10-9(12)7-4-6(13)5-8(14)11-7/h2-3,7H,4-5H2,1H3,(H,11,14)/t7-/m1/s1 |
| InChIKey | QCRBTAWHUUVNGK-SSDOTTSWSA-N |
| XLogP | -0.06 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|