C8H11N5O2 — CID 175783309
1-(aminomethyl)-5-(1-methylimidazol-2-yl)imidazolidine-2,4-dione (PubChem CID 175783309) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 1-(aminomethyl)-5-(1-methylimidazol-2-yl)imidazolidine-2,4-dione.
| Compound Name | 1-(aminomethyl)-5-(1-methylimidazol-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175783309 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(aminomethyl)-5-(1-methylimidazol-2-yl)imidazolidine-2,4-dione |
| SMILES | Cn1ccnc1C1C(=O)NC(=O)N1CN |
| InChI | InChI=1S/C8H11N5O2/c1-12-3-2-10-6(12)5-7(14)11-8(15)13(5)4-9/h2-3,5H,4,9H2,1H3,(H,11,14,15) |
| InChIKey | JPGQTYIQSBWRPR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|