C10H18O2S — CID 130643244
2-(2-cyclopentylsulfanylethyl)-1,3-dioxolane (PubChem CID 130643244) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is 2-(2-cyclopentylsulfanylethyl)-1,3-dioxolane.
| Compound Name | 2-(2-cyclopentylsulfanylethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 130643244 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-(2-cyclopentylsulfanylethyl)-1,3-dioxolane |
| SMILES | C1CCC(SCCC2OCCO2)C1 |
| InChI | InChI=1S/C10H18O2S/c1-2-4-9(3-1)13-8-5-10-11-6-7-12-10/h9-10H,1-8H2 |
| InChIKey | SWABHZGWJNPCNR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |