C7H12O2S — CID 13082344
2-(thiolan-2-yl)-1,3-dioxolane (PubChem CID 13082344) has the molecular formula C7H12O2S and a molecular weight of 160.24 g/mol. Its IUPAC name is 2-(thiolan-2-yl)-1,3-dioxolane.
| Compound Name | 2-(thiolan-2-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 13082344 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2-(thiolan-2-yl)-1,3-dioxolane |
| SMILES | C1CSC(C2OCCO2)C1 |
| InChI | InChI=1S/C7H12O2S/c1-2-6(10-5-1)7-8-3-4-9-7/h6-7H,1-5H2 |
| InChIKey | BZDDBERJBZIUMC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |