C8H14O2S2 — CID 91117914
2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dioxolane (PubChem CID 91117914) has the molecular formula C8H14O2S2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 91117914 |
| Molecular Formula | C8H14O2S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-[2-(1,3-dithiolan-2-yl)ethyl]-1,3-dioxolane |
| SMILES | C1COC(CCC2SCCS2)O1 |
| InChI | InChI=1S/C8H14O2S2/c1(7-9-3-4-10-7)2-8-11-5-6-12-8/h7-8H,1-6H2 |
| InChIKey | ZNZKRKVGEBREBY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |