C9H16O3S — CID 131154467
2-(oxolan-2-ylmethylsulfanylmethyl)-1,3-dioxolane (PubChem CID 131154467) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfanylmethyl)-1,3-dioxolane.
| Compound Name | 2-(oxolan-2-ylmethylsulfanylmethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 131154467 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfanylmethyl)-1,3-dioxolane |
| SMILES | C1COC(CSCC2OCCO2)C1 |
| InChI | InChI=1S/C9H16O3S/c1-2-8(10-3-1)6-13-7-9-11-4-5-12-9/h8-9H,1-7H2 |
| InChIKey | BIUSDQSUDPFDOP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |