C9H16O2S — CID 11148166
(3aS,4R,6R,6aS)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole (PubChem CID 11148166) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is (3aS,4R,6R,6aS)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4R,6R,6aS)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11148166 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (3aS,4R,6R,6aS)-2,2,4,6-tetramethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
| SMILES | C[C@H]1S[C@H](C)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C9H16O2S/c1-5-7-8(6(2)12-5)11-9(3,4)10-7/h5-8H,1-4H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | POVGVWXZPVLNJR-WCTZXXKLSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |